C18H23ClN2O3 — CID 168982432
tert-butyl N-[2-(3-chlorophenyl)-2-hydroxyethyl]-N-[1-(cyanomethyl)cyclopropyl]carbamate (PubChem CID 168982432) has the molecular formula C18H23ClN2O3 and a molecular weight of 350.85 g/mol. Its IUPAC name is tert-butyl N-[2-(3-chlorophenyl)-2-hydroxyethyl]-N-[1-(cyanomethyl)cyclopropyl]carbamate.
| Compound Name | tert-butyl N-[2-(3-chlorophenyl)-2-hydroxyethyl]-N-[1-(cyanomethyl)cyclopropyl]carbamate |
|---|---|
| PubChem CID | 168982432 |
| Molecular Formula | C18H23ClN2O3 |
| Molecular Weight | 350.85 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | tert-butyl N-[2-(3-chlorophenyl)-2-hydroxyethyl]-N-[1-(cyanomethyl)cyclopropyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(CC(O)c1cccc(Cl)c1)C1(CC#N)CC1 |
| InChI | InChI=1S/C18H23ClN2O3/c1-17(2,3)24-16(23)21(18(7-8-18)9-10-20)12-15(22)13-5-4-6-14(19)11-13/h4-6,11,15,22H,7-9,12H2,1-3H3 |
| InChIKey | FKSBRLXGIGPAQF-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 73.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.85 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |