C12H24N6O4S2 — CID 59364583
N-(2-hydrazinyl-2-oxoethyl)-4-[[4-[(2-hydrazinyl-2-oxoethyl)amino]-4-oxobutyl]disulfanyl]butanamide (PubChem CID 59364583) has the molecular formula C12H24N6O4S2 and a molecular weight of 380.50 g/mol. Its IUPAC name is N-(2-hydrazinyl-2-oxoethyl)-4-[[4-[(2-hydrazinyl-2-oxoethyl)amino]-4-oxobutyl]disulfanyl]butanamide.
| Compound Name | N-(2-hydrazinyl-2-oxoethyl)-4-[[4-[(2-hydrazinyl-2-oxoethyl)amino]-4-oxobutyl]disulfanyl]butanamide |
|---|---|
| PubChem CID | 59364583 |
| Molecular Formula | C12H24N6O4S2 |
| Molecular Weight | 380.50 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | N-(2-hydrazinyl-2-oxoethyl)-4-[[4-[(2-hydrazinyl-2-oxoethyl)amino]-4-oxobutyl]disulfanyl]butanamide |
| SMILES | NNC(=O)CNC(=O)CCCSSCCCC(=O)NCC(=O)NN |
| InChI | InChI=1S/C12H24N6O4S2/c13-17-11(21)7-15-9(19)3-1-5-23-24-6-2-4-10(20)16-8-12(22)18-14/h1-8,13-14H2,(H,15,19)(H,16,20)(H,17,21)(H,18,22) |
| InChIKey | FZIIRMDLQVXCAK-UHFFFAOYSA-N |
| XLogP | -1.86 |
| TPSA | 168.44 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.50 |
| LogP ≤ 5 | -1.86 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|