C30H33N5O4 — CID 59367283
tert-butyl (2S,4S)-4-isocyano-2-[[(2S)-1-oxo-4-phenyl-1-(quinolin-3-ylamino)butan-2-yl]carbamoyl]pyrrolidine-1-carboxylate (PubChem CID 59367283) has the molecular formula C30H33N5O4 and a molecular weight of 527.63 g/mol. Its IUPAC name is tert-butyl (2S,4S)-4-isocyano-2-[[(2S)-1-oxo-4-phenyl-1-(quinolin-3-ylamino)butan-2-yl]carbamoyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,4S)-4-isocyano-2-[[(2S)-1-oxo-4-phenyl-1-(quinolin-3-ylamino)butan-2-yl]carbamoyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 59367283 |
| Molecular Formula | C30H33N5O4 |
| Molecular Weight | 527.63 g/mol |
| Exact Mass | 527.25 |
| IUPAC Name | tert-butyl (2S,4S)-4-isocyano-2-[[(2S)-1-oxo-4-phenyl-1-(quinolin-3-ylamino)butan-2-yl]carbamoyl]pyrrolidine-1-carboxylate |
| SMILES | [C-]#[N+][C@H]1C[C@@H](C(=O)N[C@@H](CCc2ccccc2)C(=O)Nc2cnc3ccccc3c2)N(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C30H33N5O4/c1-30(2,3)39-29(38)35-19-23(31-4)17-26(35)28(37)34-25(15-14-20-10-6-5-7-11-20)27(36)33-22-16-21-12-8-9-13-24(21)32-18-22/h5-13,16,18,23,25-26H,14-15,17,19H2,1-3H3,(H,33,36)(H,34,37)/t23-,25-,26-/m0/s1 |
| InChIKey | VMQSPHBJABCSNU-RNXOBYDBSA-N |
| XLogP | 4.59 |
| TPSA | 104.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.63 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|