C22H24ClFN2O2 — CID 59368358
2-(9-chloro-3-methyl-1,2,4,5-tetrahydroazepino[4,5-b]indol-6-yl)-1-(3-fluoro-4-methoxyphenyl)ethanol (PubChem CID 59368358) has the molecular formula C22H24ClFN2O2 and a molecular weight of 402.90 g/mol. Its IUPAC name is 2-(9-chloro-3-methyl-1,2,4,5-tetrahydroazepino[4,5-b]indol-6-yl)-1-(3-fluoro-4-methoxyphenyl)ethanol.
| Compound Name | 2-(9-chloro-3-methyl-1,2,4,5-tetrahydroazepino[4,5-b]indol-6-yl)-1-(3-fluoro-4-methoxyphenyl)ethanol |
|---|---|
| PubChem CID | 59368358 |
| Molecular Formula | C22H24ClFN2O2 |
| Molecular Weight | 402.90 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | 2-(9-chloro-3-methyl-1,2,4,5-tetrahydroazepino[4,5-b]indol-6-yl)-1-(3-fluoro-4-methoxyphenyl)ethanol |
| SMILES | COc1ccc(C(O)Cn2c3c(c4cc(Cl)ccc42)CCN(C)CC3)cc1F |
| InChI | InChI=1S/C22H24ClFN2O2/c1-25-9-7-16-17-12-15(23)4-5-19(17)26(20(16)8-10-25)13-21(27)14-3-6-22(28-2)18(24)11-14/h3-6,11-12,21,27H,7-10,13H2,1-2H3 |
| InChIKey | LSNOATWBPHQLRK-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 37.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.90 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|