C13H17NO — CID 59369453
CID 59369453 (PubChem CID 59369453) has the molecular formula C13H17NO and a molecular weight of 203.29 g/mol.
| Compound Name | CID 59369453 |
|---|---|
| PubChem CID | 59369453 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | — |
| SMILES | [CH]c1cccc(N(C)C(=O)CC(C)C)c1 |
| InChI | InChI=1S/C13H17NO/c1-10(2)8-13(15)14(4)12-7-5-6-11(3)9-12/h3,5-7,9-10H,8H2,1-2,4H3 |
| InChIKey | AIPYAYSISSODFH-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |