C30H29Cl2F3N4O — CID 59369778
(2R,3R,4R,5S)-3-(3-chlorophenyl)-4-(4-chlorophenyl)-4-cyano-5-(2,2-dimethylpropyl)-N-[[6-(trifluoromethyl)-3-pyridinyl]methyl]pyrrolidine-2-carboxamide (PubChem CID 59369778) has the molecular formula C30H29Cl2F3N4O and a molecular weight of 589.49 g/mol. Its IUPAC name is (2R,3R,4R,5S)-3-(3-chlorophenyl)-4-(4-chlorophenyl)-4-cyano-5-(2,2-dimethylpropyl)-N-[[6-(trifluoromethyl)-3-pyridinyl]methyl]pyrrolidine-2-carboxamide.
| Compound Name | (2R,3R,4R,5S)-3-(3-chlorophenyl)-4-(4-chlorophenyl)-4-cyano-5-(2,2-dimethylpropyl)-N-[[6-(trifluoromethyl)-3-pyridinyl]methyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 59369778 |
| Molecular Formula | C30H29Cl2F3N4O |
| Molecular Weight | 589.49 g/mol |
| Exact Mass | 588.17 |
| IUPAC Name | (2R,3R,4R,5S)-3-(3-chlorophenyl)-4-(4-chlorophenyl)-4-cyano-5-(2,2-dimethylpropyl)-N-[[6-(trifluoromethyl)-3-pyridinyl]methyl]pyrrolidine-2-carboxamide |
| SMILES | CC(C)(C)C[C@@H]1N[C@@H](C(=O)NCc2ccc(C(F)(F)F)nc2)[C@H](c2cccc(Cl)c2)[C@@]1(C#N)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C30H29Cl2F3N4O/c1-28(2,3)14-24-29(17-36,20-8-10-21(31)11-9-20)25(19-5-4-6-22(32)13-19)26(39-24)27(40)38-16-18-7-12-23(37-15-18)30(33,34)35/h4-13,15,24-26,39H,14,16H2,1-3H3,(H,38,40)/t24-,25-,26+,29-/m0/s1 |
| InChIKey | GOGKBGJTZZFFRH-QNVWVOQGSA-N |
| XLogP | 7.05 |
| TPSA | 77.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.49 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |