C14H18 — CID 59372849
(6E,8S,10Z)-8-methyltrideca-6,10-dien-1,4-diyne (PubChem CID 59372849) has the molecular formula C14H18 and a molecular weight of 186.30 g/mol. Its IUPAC name is (6E,8S,10Z)-8-methyltrideca-6,10-dien-1,4-diyne.
| Compound Name | (6E,8S,10Z)-8-methyltrideca-6,10-dien-1,4-diyne |
|---|---|
| PubChem CID | 59372849 |
| Molecular Formula | C14H18 |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.14 |
| IUPAC Name | (6E,8S,10Z)-8-methyltrideca-6,10-dien-1,4-diyne |
| SMILES | C#CCC#C/C=C/[C@@H](C)C/C=C\CC |
| InChI | InChI=1S/C14H18/c1-4-6-8-9-11-13-14(3)12-10-7-5-2/h1,7,10-11,13-14H,5-6,12H2,2-3H3/b10-7-,13-11+/t14-/m0/s1 |
| InChIKey | GAVHQCWIGRZFBS-XMWJRFOLSA-N |
| XLogP | 3.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|