C17H16Cl2N4O — CID 59374577
6-chloro-8-(2-chlorophenyl)-2-methyl-9-(oxolan-2-ylmethyl)purine (PubChem CID 59374577) has the molecular formula C17H16Cl2N4O and a molecular weight of 363.25 g/mol. Its IUPAC name is 6-chloro-8-(2-chlorophenyl)-2-methyl-9-(oxolan-2-ylmethyl)purine.
| Compound Name | 6-chloro-8-(2-chlorophenyl)-2-methyl-9-(oxolan-2-ylmethyl)purine |
|---|---|
| PubChem CID | 59374577 |
| Molecular Formula | C17H16Cl2N4O |
| Molecular Weight | 363.25 g/mol |
| Exact Mass | 362.07 |
| IUPAC Name | 6-chloro-8-(2-chlorophenyl)-2-methyl-9-(oxolan-2-ylmethyl)purine |
| SMILES | Cc1nc(Cl)c2nc(-c3ccccc3Cl)n(CC3CCCO3)c2n1 |
| InChI | InChI=1S/C17H16Cl2N4O/c1-10-20-15(19)14-17(21-10)23(9-11-5-4-8-24-11)16(22-14)12-6-2-3-7-13(12)18/h2-3,6-7,11H,4-5,8-9H2,1H3 |
| InChIKey | UBAIDUXWLPHWEK-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.25 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |