C15H14Cl2N4S — CID 174676987
1-[6-chloro-8-(2-chlorophenyl)-2-methylpurin-9-yl]propane-1-thiol (PubChem CID 174676987) has the molecular formula C15H14Cl2N4S and a molecular weight of 353.28 g/mol. Its IUPAC name is 1-[6-chloro-8-(2-chlorophenyl)-2-methylpurin-9-yl]propane-1-thiol.
| Compound Name | 1-[6-chloro-8-(2-chlorophenyl)-2-methylpurin-9-yl]propane-1-thiol |
|---|---|
| PubChem CID | 174676987 |
| Molecular Formula | C15H14Cl2N4S |
| Molecular Weight | 353.28 g/mol |
| Exact Mass | 352.03 |
| IUPAC Name | 1-[6-chloro-8-(2-chlorophenyl)-2-methylpurin-9-yl]propane-1-thiol |
| SMILES | CCC(S)n1c(-c2ccccc2Cl)nc2c(Cl)nc(C)nc21 |
| InChI | InChI=1S/C15H14Cl2N4S/c1-3-11(22)21-14(9-6-4-5-7-10(9)16)20-12-13(17)18-8(2)19-15(12)21/h4-7,11,22H,3H2,1-2H3 |
| InChIKey | LWUTZGKMJMAUOM-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 43.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.28 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|