C19H21Cl2N5O2 — CID 88898990
tert-butyl N-[2-[6-chloro-8-(2-chlorophenyl)-2-methylpurin-9-yl]ethyl]carbamate (PubChem CID 88898990) has the molecular formula C19H21Cl2N5O2 and a molecular weight of 422.32 g/mol. Its IUPAC name is tert-butyl N-[2-[6-chloro-8-(2-chlorophenyl)-2-methylpurin-9-yl]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[6-chloro-8-(2-chlorophenyl)-2-methylpurin-9-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 88898990 |
| Molecular Formula | C19H21Cl2N5O2 |
| Molecular Weight | 422.32 g/mol |
| Exact Mass | 421.11 |
| IUPAC Name | tert-butyl N-[2-[6-chloro-8-(2-chlorophenyl)-2-methylpurin-9-yl]ethyl]carbamate |
| SMILES | Cc1nc(Cl)c2nc(-c3ccccc3Cl)n(CCNC(=O)OC(C)(C)C)c2n1 |
| InChI | InChI=1S/C19H21Cl2N5O2/c1-11-23-15(21)14-17(24-11)26(10-9-22-18(27)28-19(2,3)4)16(25-14)12-7-5-6-8-13(12)20/h5-8H,9-10H2,1-4H3,(H,22,27) |
| InChIKey | BFDPAJXIZOXZJO-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.32 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |