C21H16FN5O4S — CID 59379713
N-[[3-[(2-amino-3,4-dioxocyclobuten-1-yl)amino]-4-fluorophenyl]methyl]-12-oxo-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-triene-10-carboxamide (PubChem CID 59379713) has the molecular formula C21H16FN5O4S and a molecular weight of 453.46 g/mol. Its IUPAC name is N-[[3-[(2-amino-3,4-dioxocyclobuten-1-yl)amino]-4-fluorophenyl]methyl]-12-oxo-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-triene-10-carboxamide.
| Compound Name | N-[[3-[(2-amino-3,4-dioxocyclobuten-1-yl)amino]-4-fluorophenyl]methyl]-12-oxo-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-triene-10-carboxamide |
|---|---|
| PubChem CID | 59379713 |
| Molecular Formula | C21H16FN5O4S |
| Molecular Weight | 453.46 g/mol |
| Exact Mass | 453.09 |
| IUPAC Name | N-[[3-[(2-amino-3,4-dioxocyclobuten-1-yl)amino]-4-fluorophenyl]methyl]-12-oxo-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-triene-10-carboxamide |
| SMILES | Nc1c(Nc2cc(CNC(=O)c3nc4sc5c(c4c(=O)[nH]3)CCC5)ccc2F)c(=O)c1=O |
| InChI | InChI=1S/C21H16FN5O4S/c22-10-5-4-8(6-11(10)25-15-14(23)16(28)17(15)29)7-24-20(31)18-26-19(30)13-9-2-1-3-12(9)32-21(13)27-18/h4-6,25H,1-3,7,23H2,(H,24,31)(H,26,27,30) |
| InChIKey | SSCTZPAFXFRAOF-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 147.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.46 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|