C30H27ClF3N7O2 — CID 59381864
2-chloro-N-[2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-5-yl]-5-[[3-(trifluoromethyl)benzoyl]amino]benzamide (PubChem CID 59381864) has the molecular formula C30H27ClF3N7O2 and a molecular weight of 610.04 g/mol. Its IUPAC name is 2-chloro-N-[2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-5-yl]-5-[[3-(trifluoromethyl)benzoyl]amino]benzamide.
| Compound Name | 2-chloro-N-[2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-5-yl]-5-[[3-(trifluoromethyl)benzoyl]amino]benzamide |
|---|---|
| PubChem CID | 59381864 |
| Molecular Formula | C30H27ClF3N7O2 |
| Molecular Weight | 610.04 g/mol |
| Exact Mass | 609.19 |
| IUPAC Name | 2-chloro-N-[2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-5-yl]-5-[[3-(trifluoromethyl)benzoyl]amino]benzamide |
| SMILES | CN1CCN(c2ccc(Nc3ncc(NC(=O)c4cc(NC(=O)c5cccc(C(F)(F)F)c5)ccc4Cl)cn3)cc2)CC1 |
| InChI | InChI=1S/C30H27ClF3N7O2/c1-40-11-13-41(14-12-40)24-8-5-21(6-9-24)39-29-35-17-23(18-36-29)38-28(43)25-16-22(7-10-26(25)31)37-27(42)19-3-2-4-20(15-19)30(32,33)34/h2-10,15-18H,11-14H2,1H3,(H,37,42)(H,38,43)(H,35,36,39) |
| InChIKey | YJDASYVBBMSVBW-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 102.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.04 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|