C29H35N5O4S2 — CID 59381974
(3S)-3-N-(9-ethylcarbazol-3-yl)-1-N-pentyl-4-thiophen-2-ylsulfonylpiperazine-1,3-dicarboxamide (PubChem CID 59381974) has the molecular formula C29H35N5O4S2 and a molecular weight of 581.76 g/mol. Its IUPAC name is (3S)-3-N-(9-ethylcarbazol-3-yl)-1-N-pentyl-4-thiophen-2-ylsulfonylpiperazine-1,3-dicarboxamide.
| Compound Name | (3S)-3-N-(9-ethylcarbazol-3-yl)-1-N-pentyl-4-thiophen-2-ylsulfonylpiperazine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 59381974 |
| Molecular Formula | C29H35N5O4S2 |
| Molecular Weight | 581.76 g/mol |
| Exact Mass | 581.21 |
| IUPAC Name | (3S)-3-N-(9-ethylcarbazol-3-yl)-1-N-pentyl-4-thiophen-2-ylsulfonylpiperazine-1,3-dicarboxamide |
| SMILES | CCCCCNC(=O)N1CCN(S(=O)(=O)c2cccs2)[C@H](C(=O)Nc2ccc3c(c2)c2ccccc2n3CC)C1 |
| InChI | InChI=1S/C29H35N5O4S2/c1-3-5-8-15-30-29(36)32-16-17-34(40(37,38)27-12-9-18-39-27)26(20-32)28(35)31-21-13-14-25-23(19-21)22-10-6-7-11-24(22)33(25)4-2/h6-7,9-14,18-19,26H,3-5,8,15-17,20H2,1-2H3,(H,30,36)(H,31,35)/t26-/m0/s1 |
| InChIKey | DQIDABJJJCDJHF-SANMLTNESA-N |
| XLogP | 5.09 |
| TPSA | 103.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.76 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|