C27H32N4O3S3 — CID 59381960
(2S)-N-(9-ethylcarbazol-3-yl)-4-(3-methylsulfanylpropyl)-1-thiophen-2-ylsulfonylpiperazine-2-carboxamide (PubChem CID 59381960) has the molecular formula C27H32N4O3S3 and a molecular weight of 556.78 g/mol. Its IUPAC name is (2S)-N-(9-ethylcarbazol-3-yl)-4-(3-methylsulfanylpropyl)-1-thiophen-2-ylsulfonylpiperazine-2-carboxamide.
| Compound Name | (2S)-N-(9-ethylcarbazol-3-yl)-4-(3-methylsulfanylpropyl)-1-thiophen-2-ylsulfonylpiperazine-2-carboxamide |
|---|---|
| PubChem CID | 59381960 |
| Molecular Formula | C27H32N4O3S3 |
| Molecular Weight | 556.78 g/mol |
| Exact Mass | 556.16 |
| IUPAC Name | (2S)-N-(9-ethylcarbazol-3-yl)-4-(3-methylsulfanylpropyl)-1-thiophen-2-ylsulfonylpiperazine-2-carboxamide |
| SMILES | CCn1c2ccccc2c2cc(NC(=O)[C@@H]3CN(CCCSC)CCN3S(=O)(=O)c3cccs3)ccc21 |
| InChI | InChI=1S/C27H32N4O3S3/c1-3-30-23-9-5-4-8-21(23)22-18-20(11-12-24(22)30)28-27(32)25-19-29(13-7-16-35-2)14-15-31(25)37(33,34)26-10-6-17-36-26/h4-6,8-12,17-18,25H,3,7,13-16,19H2,1-2H3,(H,28,32)/t25-/m0/s1 |
| InChIKey | KLKFSSZFJYHUJP-VWLOTQADSA-N |
| XLogP | 4.94 |
| TPSA | 74.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.78 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|