C12H19NO6S — CID 59382834
2-[[(2R)-2-hydroxy-3-phenylmethoxypropyl]amino]ethyl hydrogen sulfate (PubChem CID 59382834) has the molecular formula C12H19NO6S and a molecular weight of 305.35 g/mol. Its IUPAC name is 2-[[(2R)-2-hydroxy-3-phenylmethoxypropyl]amino]ethyl hydrogen sulfate.
| Compound Name | 2-[[(2R)-2-hydroxy-3-phenylmethoxypropyl]amino]ethyl hydrogen sulfate |
|---|---|
| PubChem CID | 59382834 |
| Molecular Formula | C12H19NO6S |
| Molecular Weight | 305.35 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | 2-[[(2R)-2-hydroxy-3-phenylmethoxypropyl]amino]ethyl hydrogen sulfate |
| SMILES | O=S(=O)(O)OCCNC[C@@H](O)COCc1ccccc1 |
| InChI | InChI=1S/C12H19NO6S/c14-12(8-13-6-7-19-20(15,16)17)10-18-9-11-4-2-1-3-5-11/h1-5,12-14H,6-10H2,(H,15,16,17)/t12-/m1/s1 |
| InChIKey | DOBPGRSRZWXSIT-GFCCVEGCSA-N |
| XLogP | -0.03 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.35 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|