C24H38N2O12S2 — CID 91032143
2-aminoethyl hydrogen sulfate;2-[[(2R)-2-hydroxy-3-phenylmethoxypropyl]amino]ethyl hydrogen sulfate;(2R)-2-(phenylmethoxymethyl)oxirane (PubChem CID 91032143) has the molecular formula C24H38N2O12S2 and a molecular weight of 610.70 g/mol. Its IUPAC name is 2-aminoethyl hydrogen sulfate;2-[[(2R)-2-hydroxy-3-phenylmethoxypropyl]amino]ethyl hydrogen sulfate;(2R)-2-(phenylmethoxymethyl)oxirane.
| Compound Name | 2-aminoethyl hydrogen sulfate;2-[[(2R)-2-hydroxy-3-phenylmethoxypropyl]amino]ethyl hydrogen sulfate;(2R)-2-(phenylmethoxymethyl)oxirane |
|---|---|
| PubChem CID | 91032143 |
| Molecular Formula | C24H38N2O12S2 |
| Molecular Weight | 610.70 g/mol |
| Exact Mass | 610.19 |
| IUPAC Name | 2-aminoethyl hydrogen sulfate;2-[[(2R)-2-hydroxy-3-phenylmethoxypropyl]amino]ethyl hydrogen sulfate;(2R)-2-(phenylmethoxymethyl)oxirane |
| SMILES | NCCOS(=O)(=O)O.O=S(=O)(O)OCCNC[C@@H](O)COCc1ccccc1.c1ccc(COC[C@H]2CO2)cc1 |
| InChI | InChI=1S/C12H19NO6S.C10H12O2.C2H7NO4S/c14-12(8-13-6-7-19-20(15,16)17)10-18-9-11-4-2-1-3-5-11;1-2-4-9(5-3-1)6-11-7-10-8-12-10;3-1-2-7-8(4,5)6/h1-5,12-14H,6-10H2,(H,15,16,17);1-5,10H,6-8H2;1-3H2,(H,4,5,6)/t12-;10-;/m10./s1 |
| InChIKey | YIZIFUGXTMIZEG-SNUNQQQPSA-N |
| XLogP | 0.34 |
| TPSA | 216.47 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.70 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|