C19H21ClN4O4 — CID 59384895
ethyl 4-(4-chlorophenyl)-4-[[2-(dimethylamino)pyrimidine-5-carbonyl]amino]-3-oxobutanoate (PubChem CID 59384895) has the molecular formula C19H21ClN4O4 and a molecular weight of 404.85 g/mol. Its IUPAC name is ethyl 4-(4-chlorophenyl)-4-[[2-(dimethylamino)pyrimidine-5-carbonyl]amino]-3-oxobutanoate.
| Compound Name | ethyl 4-(4-chlorophenyl)-4-[[2-(dimethylamino)pyrimidine-5-carbonyl]amino]-3-oxobutanoate |
|---|---|
| PubChem CID | 59384895 |
| Molecular Formula | C19H21ClN4O4 |
| Molecular Weight | 404.85 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | ethyl 4-(4-chlorophenyl)-4-[[2-(dimethylamino)pyrimidine-5-carbonyl]amino]-3-oxobutanoate |
| SMILES | CCOC(=O)CC(=O)C(NC(=O)c1cnc(N(C)C)nc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H21ClN4O4/c1-4-28-16(26)9-15(25)17(12-5-7-14(20)8-6-12)23-18(27)13-10-21-19(22-11-13)24(2)3/h5-8,10-11,17H,4,9H2,1-3H3,(H,23,27) |
| InChIKey | MMKHBKKHGVSMKT-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 101.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.85 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|