C20H17N3OS — CID 59388191
2-amino-5,5-diphenyl-3-(thiophen-2-ylmethyl)imidazol-4-one (PubChem CID 59388191) has the molecular formula C20H17N3OS and a molecular weight of 347.44 g/mol. Its IUPAC name is 2-amino-5,5-diphenyl-3-(thiophen-2-ylmethyl)imidazol-4-one.
| Compound Name | 2-amino-5,5-diphenyl-3-(thiophen-2-ylmethyl)imidazol-4-one |
|---|---|
| PubChem CID | 59388191 |
| Molecular Formula | C20H17N3OS |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | 2-amino-5,5-diphenyl-3-(thiophen-2-ylmethyl)imidazol-4-one |
| SMILES | NC1=NC(c2ccccc2)(c2ccccc2)C(=O)N1Cc1cccs1 |
| InChI | InChI=1S/C20H17N3OS/c21-19-22-20(15-8-3-1-4-9-15,16-10-5-2-6-11-16)18(24)23(19)14-17-12-7-13-25-17/h1-13H,14H2,(H2,21,22) |
| InChIKey | WUHPWDUNLIERPN-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 58.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |