C44H43B — CID 59390352
(7-tert-butyl-3-phenylpyren-1-yl)-bis(2,4,6-trimethylphenyl)borane (PubChem CID 59390352) has the molecular formula C44H43B and a molecular weight of 582.64 g/mol. Its IUPAC name is (7-tert-butyl-3-phenylpyren-1-yl)-bis(2,4,6-trimethylphenyl)borane.
| Compound Name | (7-tert-butyl-3-phenylpyren-1-yl)-bis(2,4,6-trimethylphenyl)borane |
|---|---|
| PubChem CID | 59390352 |
| Molecular Formula | C44H43B |
| Molecular Weight | 582.64 g/mol |
| Exact Mass | 582.35 |
| IUPAC Name | (7-tert-butyl-3-phenylpyren-1-yl)-bis(2,4,6-trimethylphenyl)borane |
| SMILES | Cc1cc(C)c(B(c2c(C)cc(C)cc2C)c2cc(-c3ccccc3)c3ccc4cc(C(C)(C)C)cc5ccc2c3c54)c(C)c1 |
| InChI | InChI=1S/C44H43B/c1-26-19-28(3)42(29(4)20-26)45(43-30(5)21-27(2)22-31(43)6)39-25-38(32-13-11-10-12-14-32)36-17-15-33-23-35(44(7,8)9)24-34-16-18-37(39)41(36)40(33)34/h10-25H,1-9H3 |
| InChIKey | CIBGFRVOGHFMQN-UHFFFAOYSA-N |
| XLogP | 9.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.64 |
| LogP ≤ 5 | 9.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|