C33H46B2O4 — CID 59391317
(9-borono-7,7-dioctylbenzo[c]fluoren-5-yl)boronic acid (PubChem CID 59391317) has the molecular formula C33H46B2O4 and a molecular weight of 528.35 g/mol. Its IUPAC name is (9-borono-7,7-dioctylbenzo[c]fluoren-5-yl)boronic acid.
| Compound Name | (9-borono-7,7-dioctylbenzo[c]fluoren-5-yl)boronic acid |
|---|---|
| PubChem CID | 59391317 |
| Molecular Formula | C33H46B2O4 |
| Molecular Weight | 528.35 g/mol |
| Exact Mass | 528.36 |
| IUPAC Name | (9-borono-7,7-dioctylbenzo[c]fluoren-5-yl)boronic acid |
| SMILES | CCCCCCCCC1(CCCCCCCC)c2cc(B(O)O)ccc2-c2c1cc(B(O)O)c1ccccc21 |
| InChI | InChI=1S/C33H46B2O4/c1-3-5-7-9-11-15-21-33(22-16-12-10-8-6-4-2)29-23-25(34(36)37)19-20-28(29)32-27-18-14-13-17-26(27)31(35(38)39)24-30(32)33/h13-14,17-20,23-24,36-39H,3-12,15-16,21-22H2,1-2H3 |
| InChIKey | OAQRHUPGJVUSPJ-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.35 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|