(9-borono-7,7-dioctylbenzo[c]fluoren-5-yl)boronic acid

C33H46B2O4 — CID 59391317

IUPAC(9-borono-7,7-dioctylbenzo[c]fluoren-5-yl)boronic acid
SMILESCCCCCCCCC1(CCCCCCCC)c2cc(B(O)O)ccc2-c2c1cc(B(O)O)c1ccccc21
InChIInChI=1S/C33H46B2O4/c1-3-5-7-9-11-15-21-33(22-16-12-10-8-6-4-2)29-23-25(34(36)37)19-20-28(29)32-27-18-14-13-17-26(27)31(35(38)39)24-30(32)33/h13-14,17-20,23-24,36-39H,3-12,15-16,21-22H2,1-2H3
InChIKeyOAQRHUPGJVUSPJ-UHFFFAOYSA-N
MW528.35 g/mol
LogP5.97
Rot. Bonds16

About (9-borono-7,7-dioctylbenzo[c]fluoren-5-yl)boronic acid

(9-borono-7,7-dioctylbenzo[c]fluoren-5-yl)boronic acid (PubChem CID 59391317) has the molecular formula C33H46B2O4 and a molecular weight of 528.35 g/mol. Its IUPAC name is (9-borono-7,7-dioctylbenzo[c]fluoren-5-yl)boronic acid.

Molecular Properties

Compound Name(9-borono-7,7-dioctylbenzo[c]fluoren-5-yl)boronic acid
PubChem CID59391317
Molecular FormulaC33H46B2O4
Molecular Weight528.35 g/mol
Exact Mass528.36
IUPAC Name(9-borono-7,7-dioctylbenzo[c]fluoren-5-yl)boronic acid
SMILESCCCCCCCCC1(CCCCCCCC)c2cc(B(O)O)ccc2-c2c1cc(B(O)O)c1ccccc21
InChIInChI=1S/C33H46B2O4/c1-3-5-7-9-11-15-21-33(22-16-12-10-8-6-4-2)29-23-25(34(36)37)19-20-28(29)32-27-18-14-13-17-26(27)31(35(38)39)24-30(32)33/h13-14,17-20,23-24,36-39H,3-12,15-16,21-22H2,1-2H3
InChIKeyOAQRHUPGJVUSPJ-UHFFFAOYSA-N
XLogP5.97
TPSA80.92 Ų
H-Bond Donors4
H-Bond Acceptors4
Rotatable Bonds16
Heavy Atoms39
Complexity

Lipinski Rule of Five

2 violations

RuleValue
MW ≤ 500528.35
LogP ≤ 55.97
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze (9-borono-7,7-dioctylbenzo[c]fluoren-5-yl)boronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (9-borono-7,7-dioctylbenzo[c]fluoren-5-yl)boronic acid?
The IUPAC name of (9-borono-7,7-dioctylbenzo[c]fluoren-5-yl)boronic acid (CID 59391317) is (9-borono-7,7-dioctylbenzo[c]fluoren-5-yl)boronic acid.
What is the SMILES notation for (9-borono-7,7-dioctylbenzo[c]fluoren-5-yl)boronic acid?
The canonical SMILES for (9-borono-7,7-dioctylbenzo[c]fluoren-5-yl)boronic acid is CCCCCCCCC1(CCCCCCCC)c2cc(B(O)O)ccc2-c2c1cc(B(O)O)c1ccccc21.
What is the InChIKey of (9-borono-7,7-dioctylbenzo[c]fluoren-5-yl)boronic acid?
The InChIKey is OAQRHUPGJVUSPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C33H46B2O4/c1-3-5-7-9-11-15-21-33(22-16-12-10-8-6-4-2)29-23-25(34(36)37)19-20-28(29)32-27-18-14-13-17-26(27)31(35(38)39)24-30(32)33/h13-14,17-20,23-24,36-39H,3-12,15-16,21-22H2,1-2H3.
What are the key properties of (9-borono-7,7-dioctylbenzo[c]fluoren-5-yl)boronic acid?
(9-borono-7,7-dioctylbenzo[c]fluoren-5-yl)boronic acid has a molecular weight of 528.35 g/mol, XLogP of 5.97, 16 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (9-borono-7,7-dioctylbenzo[c]fluoren-5-yl)boronic acid is sourced from PubChem (CID 59391317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).