C6H9ClN4O — CID 593923
4-chloro-1,3-dimethylpyrazole-5-carbohydrazide (PubChem CID 593923) has the molecular formula C6H9ClN4O and a molecular weight of 188.62 g/mol. Its IUPAC name is 4-chloro-1,3-dimethylpyrazole-5-carbohydrazide.
| Compound Name | 4-chloro-1,3-dimethylpyrazole-5-carbohydrazide |
|---|---|
| PubChem CID | 593923 |
| Molecular Formula | C6H9ClN4O |
| Molecular Weight | 188.62 g/mol |
| Exact Mass | 188.05 |
| IUPAC Name | 4-chloro-1,3-dimethylpyrazole-5-carbohydrazide |
| SMILES | Cc1nn(C)c(C(=O)NN)c1Cl |
| InChI | InChI=1S/C6H9ClN4O/c1-3-4(7)5(6(12)9-8)11(2)10-3/h8H2,1-2H3,(H,9,12) |
| InChIKey | JZTBRQZNXALQSP-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.62 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|