C13H20ClN5O2 — CID 831788
1-[(4-chloro-1,3-dimethylpyrazole-5-carbonyl)amino]-3-cyclohexylurea (PubChem CID 831788) has the molecular formula C13H20ClN5O2 and a molecular weight of 313.79 g/mol. Its IUPAC name is 1-[(4-chloro-1,3-dimethylpyrazole-5-carbonyl)amino]-3-cyclohexylurea.
| Compound Name | 1-[(4-chloro-1,3-dimethylpyrazole-5-carbonyl)amino]-3-cyclohexylurea |
|---|---|
| PubChem CID | 831788 |
| Molecular Formula | C13H20ClN5O2 |
| Molecular Weight | 313.79 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | 1-[(4-chloro-1,3-dimethylpyrazole-5-carbonyl)amino]-3-cyclohexylurea |
| SMILES | Cc1nn(C)c(C(=O)NNC(=O)NC2CCCCC2)c1Cl |
| InChI | InChI=1S/C13H20ClN5O2/c1-8-10(14)11(19(2)18-8)12(20)16-17-13(21)15-9-6-4-3-5-7-9/h9H,3-7H2,1-2H3,(H,16,20)(H2,15,17,21) |
| InChIKey | PDJZHFUCHLOXMQ-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 88.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.79 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|