About 2-(3-ethyl-2-oxo-1H-quinolin-7-yl)-2,3-diphenylpropanenitrile
2-(3-ethyl-2-oxo-1H-quinolin-7-yl)-2,3-diphenylpropanenitrile (PubChem CID 59393258) has the molecular formula C26H22N2O
and a molecular weight of 378.48 g/mol. Its IUPAC name is 2-(3-ethyl-2-oxo-1H-quinolin-7-yl)-2,3-diphenylpropanenitrile.
Molecular Properties
| Compound Name | 2-(3-ethyl-2-oxo-1H-quinolin-7-yl)-2,3-diphenylpropanenitrile |
| PubChem CID | 59393258 |
| Molecular Formula | C26H22N2O |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | 2-(3-ethyl-2-oxo-1H-quinolin-7-yl)-2,3-diphenylpropanenitrile |
| SMILES | CCc1cc2ccc(C(C#N)(Cc3ccccc3)c3ccccc3)cc2[nH]c1=O |
| InChI | InChI=1S/C26H22N2O/c1-2-20-15-21-13-14-23(16-24(21)28-25(20)29)26(18-27,22-11-7-4-8-12-22)17-19-9-5-3-6-10-19/h3-16H,2,17H2,1H3,(H,28,29) |
| InChIKey | FEVFYAUYCVBVFT-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(3-ethyl-2-oxo-1H-quinolin-7-yl)-2,3-diphenylpropanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-ethyl-2-oxo-1H-quinolin-7-yl)-2,3-diphenylpropanenitrile?
The IUPAC name of 2-(3-ethyl-2-oxo-1H-quinolin-7-yl)-2,3-diphenylpropanenitrile (CID 59393258) is 2-(3-ethyl-2-oxo-1H-quinolin-7-yl)-2,3-diphenylpropanenitrile.
What is the SMILES notation for 2-(3-ethyl-2-oxo-1H-quinolin-7-yl)-2,3-diphenylpropanenitrile?
The canonical SMILES for 2-(3-ethyl-2-oxo-1H-quinolin-7-yl)-2,3-diphenylpropanenitrile is CCc1cc2ccc(C(C#N)(Cc3ccccc3)c3ccccc3)cc2[nH]c1=O.
What is the InChIKey of 2-(3-ethyl-2-oxo-1H-quinolin-7-yl)-2,3-diphenylpropanenitrile?
The InChIKey is FEVFYAUYCVBVFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H22N2O/c1-2-20-15-21-13-14-23(16-24(21)28-25(20)29)26(18-27,22-11-7-4-8-12-22)17-19-9-5-3-6-10-19/h3-16H,2,17H2,1H3,(H,28,29).
What are the key properties of 2-(3-ethyl-2-oxo-1H-quinolin-7-yl)-2,3-diphenylpropanenitrile?
2-(3-ethyl-2-oxo-1H-quinolin-7-yl)-2,3-diphenylpropanenitrile has a molecular weight of 378.48 g/mol, XLogP of 5.14, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-ethyl-2-oxo-1H-quinolin-7-yl)-2,3-diphenylpropanenitrile is sourced from PubChem (CID 59393258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).