C11H18NO2+ — CID 59396030
1-[(4S)-2,2-dimethyl-4-prop-2-enyl-1,3-oxazolidin-3-yl]propan-1-one (PubChem CID 59396030) has the molecular formula C11H18NO2+ and a molecular weight of 196.27 g/mol. Its IUPAC name is 1-[(4S)-2,2-dimethyl-4-prop-2-enyl-1,3-oxazolidin-3-yl]propan-1-one.
| Compound Name | 1-[(4S)-2,2-dimethyl-4-prop-2-enyl-1,3-oxazolidin-3-yl]propan-1-one |
|---|---|
| PubChem CID | 59396030 |
| Molecular Formula | C11H18NO2+ |
| Molecular Weight | 196.27 g/mol |
| Exact Mass | 196.13 |
| IUPAC Name | 1-[(4S)-2,2-dimethyl-4-prop-2-enyl-1,3-oxazolidin-3-yl]propan-1-one |
| SMILES | C=CC[C@H]1COC(C)(C)N1C(=O)C[CH2+] |
| InChI | InChI=1S/C11H18NO2/c1-5-7-9-8-14-11(3,4)12(9)10(13)6-2/h5,9H,1-2,6-8H2,3-4H3/q+1/t9-/m0/s1 |
| InChIKey | FAFWFRVBKTZYML-VIFPVBQESA-N |
| XLogP | 1.75 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.27 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|