C10H19N2O2+ — CID 59396010
[2-[(4S)-2,2-dimethyl-4-prop-2-enyl-1,3-oxazolidin-3-yl]-2-oxoethyl]azanium (PubChem CID 59396010) has the molecular formula C10H19N2O2+ and a molecular weight of 199.27 g/mol. Its IUPAC name is [2-[(4S)-2,2-dimethyl-4-prop-2-enyl-1,3-oxazolidin-3-yl]-2-oxoethyl]azanium.
| Compound Name | [2-[(4S)-2,2-dimethyl-4-prop-2-enyl-1,3-oxazolidin-3-yl]-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 59396010 |
| Molecular Formula | C10H19N2O2+ |
| Molecular Weight | 199.27 g/mol |
| Exact Mass | 199.14 |
| IUPAC Name | [2-[(4S)-2,2-dimethyl-4-prop-2-enyl-1,3-oxazolidin-3-yl]-2-oxoethyl]azanium |
| SMILES | C=CC[C@H]1COC(C)(C)N1C(=O)C[NH3+] |
| InChI | InChI=1S/C10H18N2O2/c1-4-5-8-7-14-10(2,3)12(8)9(13)6-11/h4,8H,1,5-7,11H2,2-3H3/p+1/t8-/m0/s1 |
| InChIKey | CGNFBQCXHRXFRR-QMMMGPOBSA-O |
| XLogP | -0.23 |
| TPSA | 57.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.27 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|