C20H27N3O4 — CID 59397310
3-methoxypropyl N-ethyl-N-[4-(1H-imidazol-5-ylmethyl)-3,4-dihydro-2H-chromen-6-yl]carbamate (PubChem CID 59397310) has the molecular formula C20H27N3O4 and a molecular weight of 373.45 g/mol. Its IUPAC name is 3-methoxypropyl N-ethyl-N-[4-(1H-imidazol-5-ylmethyl)-3,4-dihydro-2H-chromen-6-yl]carbamate.
| Compound Name | 3-methoxypropyl N-ethyl-N-[4-(1H-imidazol-5-ylmethyl)-3,4-dihydro-2H-chromen-6-yl]carbamate |
|---|---|
| PubChem CID | 59397310 |
| Molecular Formula | C20H27N3O4 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.20 |
| IUPAC Name | 3-methoxypropyl N-ethyl-N-[4-(1H-imidazol-5-ylmethyl)-3,4-dihydro-2H-chromen-6-yl]carbamate |
| SMILES | CCN(C(=O)OCCCOC)c1ccc2c(c1)C(Cc1cnc[nH]1)CCO2 |
| InChI | InChI=1S/C20H27N3O4/c1-3-23(20(24)27-9-4-8-25-2)17-5-6-19-18(12-17)15(7-10-26-19)11-16-13-21-14-22-16/h5-6,12-15H,3-4,7-11H2,1-2H3,(H,21,22) |
| InChIKey | AAHNTEIRCSMTQD-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 76.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|