C18H22N6O — CID 89046376
3-cyano-1-ethyl-1-[4-(1H-imidazol-5-ylmethyl)-3,4-dihydro-2H-chromen-6-yl]-2-methylguanidine (PubChem CID 89046376) has the molecular formula C18H22N6O and a molecular weight of 338.42 g/mol. Its IUPAC name is 3-cyano-1-ethyl-1-[4-(1H-imidazol-5-ylmethyl)-3,4-dihydro-2H-chromen-6-yl]-2-methylguanidine.
| Compound Name | 3-cyano-1-ethyl-1-[4-(1H-imidazol-5-ylmethyl)-3,4-dihydro-2H-chromen-6-yl]-2-methylguanidine |
|---|---|
| PubChem CID | 89046376 |
| Molecular Formula | C18H22N6O |
| Molecular Weight | 338.42 g/mol |
| Exact Mass | 338.19 |
| IUPAC Name | 3-cyano-1-ethyl-1-[4-(1H-imidazol-5-ylmethyl)-3,4-dihydro-2H-chromen-6-yl]-2-methylguanidine |
| SMILES | CCN(/C(=N/C)NC#N)c1ccc2c(c1)C(Cc1cnc[nH]1)CCO2 |
| InChI | InChI=1S/C18H22N6O/c1-3-24(18(20-2)22-11-19)15-4-5-17-16(9-15)13(6-7-25-17)8-14-10-21-12-23-14/h4-5,9-10,12-13H,3,6-8H2,1-2H3,(H,20,22)(H,21,23) |
| InChIKey | LHXVBLIZGCMYCE-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 89.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.42 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|