C21H14F8N3OPt- — CID 59399095
2-[6-[2-[6-(2,6-difluoro-4H-pyridin-4-id-3-yl)-2-pyridinyl]propan-2-yl]-2-pyridinyl]-1,1,1,3,3,3-hexafluoropropan-2-ol;platinum (PubChem CID 59399095) has the molecular formula C21H14F8N3OPt- and a molecular weight of 671.43 g/mol. Its IUPAC name is 2-[6-[2-[6-(2,6-difluoro-4H-pyridin-4-id-3-yl)-2-pyridinyl]propan-2-yl]-2-pyridinyl]-1,1,1,3,3,3-hexafluoropropan-2-ol;platinum.
| Compound Name | 2-[6-[2-[6-(2,6-difluoro-4H-pyridin-4-id-3-yl)-2-pyridinyl]propan-2-yl]-2-pyridinyl]-1,1,1,3,3,3-hexafluoropropan-2-ol;platinum |
|---|---|
| PubChem CID | 59399095 |
| Molecular Formula | C21H14F8N3OPt- |
| Molecular Weight | 671.43 g/mol |
| Exact Mass | 671.07 |
| IUPAC Name | 2-[6-[2-[6-(2,6-difluoro-4H-pyridin-4-id-3-yl)-2-pyridinyl]propan-2-yl]-2-pyridinyl]-1,1,1,3,3,3-hexafluoropropan-2-ol;platinum |
| SMILES | CC(C)(c1cccc(-c2[c-]cc(F)nc2F)n1)c1cccc(C(O)(C(F)(F)F)C(F)(F)F)n1.[Pt] |
| InChI | InChI=1S/C21H14F8N3O.Pt/c1-18(2,13-6-3-5-12(30-13)11-9-10-16(22)32-17(11)23)14-7-4-8-15(31-14)19(33,20(24,25)26)21(27,28)29;/h3-8,10,33H,1-2H3;/q-1; |
| InChIKey | VJVHIIWTGYLNIT-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 58.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.43 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|