C21H15F5N3O2Pt- — CID 59399219
6-[2-[6-[6-(1,1,2,2,2-pentafluoroethyl)-4H-pyridin-4-id-3-yl]-2-pyridinyl]propan-2-yl]pyridine-2-carboxylic acid;platinum (PubChem CID 59399219) has the molecular formula C21H15F5N3O2Pt- and a molecular weight of 631.44 g/mol. Its IUPAC name is 6-[2-[6-[6-(1,1,2,2,2-pentafluoroethyl)-4H-pyridin-4-id-3-yl]-2-pyridinyl]propan-2-yl]pyridine-2-carboxylic acid;platinum.
| Compound Name | 6-[2-[6-[6-(1,1,2,2,2-pentafluoroethyl)-4H-pyridin-4-id-3-yl]-2-pyridinyl]propan-2-yl]pyridine-2-carboxylic acid;platinum |
|---|---|
| PubChem CID | 59399219 |
| Molecular Formula | C21H15F5N3O2Pt- |
| Molecular Weight | 631.44 g/mol |
| Exact Mass | 631.07 |
| IUPAC Name | 6-[2-[6-[6-(1,1,2,2,2-pentafluoroethyl)-4H-pyridin-4-id-3-yl]-2-pyridinyl]propan-2-yl]pyridine-2-carboxylic acid;platinum |
| SMILES | CC(C)(c1cccc(C(=O)O)n1)c1cccc(-c2[c-]cc(C(F)(F)C(F)(F)F)nc2)n1.[Pt] |
| InChI | InChI=1S/C21H15F5N3O2.Pt/c1-19(2,16-8-4-6-14(29-16)18(30)31)15-7-3-5-13(28-15)12-9-10-17(27-11-12)20(22,23)21(24,25)26;/h3-8,10-11H,1-2H3,(H,30,31);/q-1; |
| InChIKey | QFWUXWPRFBCTLO-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 75.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.44 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|