C21H15F8N3O — CID 59399096
2-[6-[2-[6-(2,6-difluoro-3-pyridinyl)-2-pyridinyl]propan-2-yl]-2-pyridinyl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 59399096) has the molecular formula C21H15F8N3O and a molecular weight of 477.36 g/mol. Its IUPAC name is 2-[6-[2-[6-(2,6-difluoro-3-pyridinyl)-2-pyridinyl]propan-2-yl]-2-pyridinyl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[6-[2-[6-(2,6-difluoro-3-pyridinyl)-2-pyridinyl]propan-2-yl]-2-pyridinyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 59399096 |
| Molecular Formula | C21H15F8N3O |
| Molecular Weight | 477.36 g/mol |
| Exact Mass | 477.11 |
| IUPAC Name | 2-[6-[2-[6-(2,6-difluoro-3-pyridinyl)-2-pyridinyl]propan-2-yl]-2-pyridinyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | CC(C)(c1cccc(-c2ccc(F)nc2F)n1)c1cccc(C(O)(C(F)(F)F)C(F)(F)F)n1 |
| InChI | InChI=1S/C21H15F8N3O/c1-18(2,13-6-3-5-12(30-13)11-9-10-16(22)32-17(11)23)14-7-4-8-15(31-14)19(33,20(24,25)26)21(27,28)29/h3-10,33H,1-2H3 |
| InChIKey | IFEFEOFJKXVRNU-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 58.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.36 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|