C19H17F2N3O — CID 59399260
[6-[2-[6-(2,6-difluoro-3-pyridinyl)-2-pyridinyl]propan-2-yl]-2-pyridinyl]methanol (PubChem CID 59399260) has the molecular formula C19H17F2N3O and a molecular weight of 341.36 g/mol. Its IUPAC name is [6-[2-[6-(2,6-difluoro-3-pyridinyl)-2-pyridinyl]propan-2-yl]-2-pyridinyl]methanol.
| Compound Name | [6-[2-[6-(2,6-difluoro-3-pyridinyl)-2-pyridinyl]propan-2-yl]-2-pyridinyl]methanol |
|---|---|
| PubChem CID | 59399260 |
| Molecular Formula | C19H17F2N3O |
| Molecular Weight | 341.36 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | [6-[2-[6-(2,6-difluoro-3-pyridinyl)-2-pyridinyl]propan-2-yl]-2-pyridinyl]methanol |
| SMILES | CC(C)(c1cccc(CO)n1)c1cccc(-c2ccc(F)nc2F)n1 |
| InChI | InChI=1S/C19H17F2N3O/c1-19(2,15-7-3-5-12(11-25)22-15)16-8-4-6-14(23-16)13-9-10-17(20)24-18(13)21/h3-10,25H,11H2,1-2H3 |
| InChIKey | XQKCTTFWWNUROU-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 58.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.36 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|