C21H20FNO — CID 14460148
[4-(4-fluorophenyl)-6-phenyl-2-propan-2-yl-3-pyridinyl]methanol (PubChem CID 14460148) has the molecular formula C21H20FNO and a molecular weight of 321.40 g/mol. Its IUPAC name is [4-(4-fluorophenyl)-6-phenyl-2-propan-2-yl-3-pyridinyl]methanol.
| Compound Name | [4-(4-fluorophenyl)-6-phenyl-2-propan-2-yl-3-pyridinyl]methanol |
|---|---|
| PubChem CID | 14460148 |
| Molecular Formula | C21H20FNO |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | [4-(4-fluorophenyl)-6-phenyl-2-propan-2-yl-3-pyridinyl]methanol |
| SMILES | CC(C)c1nc(-c2ccccc2)cc(-c2ccc(F)cc2)c1CO |
| InChI | InChI=1S/C21H20FNO/c1-14(2)21-19(13-24)18(15-8-10-17(22)11-9-15)12-20(23-21)16-6-4-3-5-7-16/h3-12,14,24H,13H2,1-2H3 |
| InChIKey | XFLFWAQPGKOZSI-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |