C31H24F2N3OPt- — CID 59399274
[6-[2-[6-(2,6-difluoro-4H-pyridin-4-id-3-yl)-2-pyridinyl]propan-2-yl]-2-pyridinyl]-diphenylmethanol;platinum (PubChem CID 59399274) has the molecular formula C31H24F2N3OPt- and a molecular weight of 687.63 g/mol. Its IUPAC name is [6-[2-[6-(2,6-difluoro-4H-pyridin-4-id-3-yl)-2-pyridinyl]propan-2-yl]-2-pyridinyl]-diphenylmethanol;platinum.
| Compound Name | [6-[2-[6-(2,6-difluoro-4H-pyridin-4-id-3-yl)-2-pyridinyl]propan-2-yl]-2-pyridinyl]-diphenylmethanol;platinum |
|---|---|
| PubChem CID | 59399274 |
| Molecular Formula | C31H24F2N3OPt- |
| Molecular Weight | 687.63 g/mol |
| Exact Mass | 687.15 |
| IUPAC Name | [6-[2-[6-(2,6-difluoro-4H-pyridin-4-id-3-yl)-2-pyridinyl]propan-2-yl]-2-pyridinyl]-diphenylmethanol;platinum |
| SMILES | CC(C)(c1cccc(-c2[c-]cc(F)nc2F)n1)c1cccc(C(O)(c2ccccc2)c2ccccc2)n1.[Pt] |
| InChI | InChI=1S/C31H24F2N3O.Pt/c1-30(2,25-16-9-15-24(34-25)23-19-20-28(32)36-29(23)33)26-17-10-18-27(35-26)31(37,21-11-5-3-6-12-21)22-13-7-4-8-14-22;/h3-18,20,37H,1-2H3;/q-1; |
| InChIKey | OVIMIWIWAQGSLP-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 58.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.63 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|