C31H25F2N3O — CID 59399275
[6-[2-[6-(2,6-difluoro-3-pyridinyl)-2-pyridinyl]propan-2-yl]-2-pyridinyl]-diphenylmethanol (PubChem CID 59399275) has the molecular formula C31H25F2N3O and a molecular weight of 493.56 g/mol. Its IUPAC name is [6-[2-[6-(2,6-difluoro-3-pyridinyl)-2-pyridinyl]propan-2-yl]-2-pyridinyl]-diphenylmethanol.
| Compound Name | [6-[2-[6-(2,6-difluoro-3-pyridinyl)-2-pyridinyl]propan-2-yl]-2-pyridinyl]-diphenylmethanol |
|---|---|
| PubChem CID | 59399275 |
| Molecular Formula | C31H25F2N3O |
| Molecular Weight | 493.56 g/mol |
| Exact Mass | 493.20 |
| IUPAC Name | [6-[2-[6-(2,6-difluoro-3-pyridinyl)-2-pyridinyl]propan-2-yl]-2-pyridinyl]-diphenylmethanol |
| SMILES | CC(C)(c1cccc(-c2ccc(F)nc2F)n1)c1cccc(C(O)(c2ccccc2)c2ccccc2)n1 |
| InChI | InChI=1S/C31H25F2N3O/c1-30(2,25-16-9-15-24(34-25)23-19-20-28(32)36-29(23)33)26-17-10-18-27(35-26)31(37,21-11-5-3-6-12-21)22-13-7-4-8-14-22/h3-20,37H,1-2H3 |
| InChIKey | LKNMXHQLPUELKS-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 58.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.56 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|