C26H22F2N4O3S — CID 59399294
6-[2-[6-(2,6-difluoro-3-pyridinyl)-2-pyridinyl]propan-2-yl]-N-(4-methylphenyl)sulfonylpyridine-2-carboxamide (PubChem CID 59399294) has the molecular formula C26H22F2N4O3S and a molecular weight of 508.55 g/mol. Its IUPAC name is 6-[2-[6-(2,6-difluoro-3-pyridinyl)-2-pyridinyl]propan-2-yl]-N-(4-methylphenyl)sulfonylpyridine-2-carboxamide.
| Compound Name | 6-[2-[6-(2,6-difluoro-3-pyridinyl)-2-pyridinyl]propan-2-yl]-N-(4-methylphenyl)sulfonylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 59399294 |
| Molecular Formula | C26H22F2N4O3S |
| Molecular Weight | 508.55 g/mol |
| Exact Mass | 508.14 |
| IUPAC Name | 6-[2-[6-(2,6-difluoro-3-pyridinyl)-2-pyridinyl]propan-2-yl]-N-(4-methylphenyl)sulfonylpyridine-2-carboxamide |
| SMILES | Cc1ccc(S(=O)(=O)NC(=O)c2cccc(C(C)(C)c3cccc(-c4ccc(F)nc4F)n3)n2)cc1 |
| InChI | InChI=1S/C26H22F2N4O3S/c1-16-10-12-17(13-11-16)36(34,35)32-25(33)20-7-5-9-22(30-20)26(2,3)21-8-4-6-19(29-21)18-14-15-23(27)31-24(18)28/h4-15H,1-3H3,(H,32,33) |
| InChIKey | RHRMUWXHPFLFAU-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 101.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.55 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|