C32H20AlF5N2O3 — CID 59399538
bis[(2-methylquinolin-8-yl)oxy]-[4-(2,3,4,5,6-pentafluorophenyl)phenoxy]alumane (PubChem CID 59399538) has the molecular formula C32H20AlF5N2O3 and a molecular weight of 602.50 g/mol. Its IUPAC name is bis[(2-methylquinolin-8-yl)oxy]-[4-(2,3,4,5,6-pentafluorophenyl)phenoxy]alumane.
| Compound Name | bis[(2-methylquinolin-8-yl)oxy]-[4-(2,3,4,5,6-pentafluorophenyl)phenoxy]alumane |
|---|---|
| PubChem CID | 59399538 |
| Molecular Formula | C32H20AlF5N2O3 |
| Molecular Weight | 602.50 g/mol |
| Exact Mass | 602.12 |
| IUPAC Name | bis[(2-methylquinolin-8-yl)oxy]-[4-(2,3,4,5,6-pentafluorophenyl)phenoxy]alumane |
| SMILES | Cc1ccc2cccc(O[Al](Oc3ccc(-c4c(F)c(F)c(F)c(F)c4F)cc3)Oc3cccc4ccc(C)nc34)c2n1 |
| InChI | InChI=1S/C12H5F5O.2C10H9NO.Al/c13-8-7(5-1-3-6(18)4-2-5)9(14)11(16)12(17)10(8)15;2*1-7-5-6-8-3-2-4-9(12)10(8)11-7;/h1-4,18H;2*2-6,12H,1H3;/q;;;+3/p-3 |
| InChIKey | MJWOIFNKGLBGKS-UHFFFAOYSA-K |
| XLogP | 8.28 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.50 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|