About methyl 3-[(3-methylbenzene-4-id-1-yl)diazenyl]benzene-6-ide-1-carboxylate;tetrakis(yttrium)
methyl 3-[(3-methylbenzene-4-id-1-yl)diazenyl]benzene-6-ide-1-carboxylate;tetrakis(yttrium) (PubChem CID 59400351) has the molecular formula C15H12N2O2Y4-2
and a molecular weight of 607.90 g/mol. Its IUPAC name is methyl 3-[(3-methylbenzene-4-id-1-yl)diazenyl]benzene-6-ide-1-carboxylate;tetrakis(yttrium).
Molecular Properties
| Compound Name | methyl 3-[(3-methylbenzene-4-id-1-yl)diazenyl]benzene-6-ide-1-carboxylate;tetrakis(yttrium) |
| PubChem CID | 59400351 |
| Molecular Formula | C15H12N2O2Y4-2 |
| Molecular Weight | 607.90 g/mol |
| Exact Mass | 607.71 |
| IUPAC Name | methyl 3-[(3-methylbenzene-4-id-1-yl)diazenyl]benzene-6-ide-1-carboxylate;tetrakis(yttrium) |
| SMILES | COC(=O)c1[c-]ccc(/N=N/c2cc[c-]c(C)c2)c1.[Y].[Y].[Y].[Y] |
| InChI | InChI=1S/C15H12N2O2.4Y/c1-11-5-3-7-13(9-11)16-17-14-8-4-6-12(10-14)15(18)19-2;;;;/h3-4,7-10H,1-2H3;;;;/q-2;;;;/b17-16+;;;; |
| InChIKey | ZAJIBXDXJAJXHG-PGXCWKBOSA-N |
| XLogP | 3.79 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 607.90 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-[(3-methylbenzene-4-id-1-yl)diazenyl]benzene-6-ide-1-carboxylate;tetrakis(yttrium) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[(3-methylbenzene-4-id-1-yl)diazenyl]benzene-6-ide-1-carboxylate;tetrakis(yttrium)?
The IUPAC name of methyl 3-[(3-methylbenzene-4-id-1-yl)diazenyl]benzene-6-ide-1-carboxylate;tetrakis(yttrium) (CID 59400351) is methyl 3-[(3-methylbenzene-4-id-1-yl)diazenyl]benzene-6-ide-1-carboxylate;tetrakis(yttrium).
What is the SMILES notation for methyl 3-[(3-methylbenzene-4-id-1-yl)diazenyl]benzene-6-ide-1-carboxylate;tetrakis(yttrium)?
The canonical SMILES for methyl 3-[(3-methylbenzene-4-id-1-yl)diazenyl]benzene-6-ide-1-carboxylate;tetrakis(yttrium) is COC(=O)c1[c-]ccc(/N=N/c2cc[c-]c(C)c2)c1.[Y].[Y].[Y].[Y].
What is the InChIKey of methyl 3-[(3-methylbenzene-4-id-1-yl)diazenyl]benzene-6-ide-1-carboxylate;tetrakis(yttrium)?
The InChIKey is ZAJIBXDXJAJXHG-PGXCWKBOSA-N. The full InChI is InChI=1S/C15H12N2O2.4Y/c1-11-5-3-7-13(9-11)16-17-14-8-4-6-12(10-14)15(18)19-2;;;;/h3-4,7-10H,1-2H3;;;;/q-2;;;;/b17-16+;;;;.
What are the key properties of methyl 3-[(3-methylbenzene-4-id-1-yl)diazenyl]benzene-6-ide-1-carboxylate;tetrakis(yttrium)?
methyl 3-[(3-methylbenzene-4-id-1-yl)diazenyl]benzene-6-ide-1-carboxylate;tetrakis(yttrium) has a molecular weight of 607.90 g/mol, XLogP of 3.79, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[(3-methylbenzene-4-id-1-yl)diazenyl]benzene-6-ide-1-carboxylate;tetrakis(yttrium) is sourced from PubChem (CID 59400351), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).