C6Cl4F4N2S2 — CID 594030
2,3-dichloro-3-[(1,2-dichloro-2-cyano-1,2-difluoroethyl)disulfanyl]-2,3-difluoropropanenitrile (PubChem CID 594030) has the molecular formula C6Cl4F4N2S2 and a molecular weight of 382.02 g/mol. Its IUPAC name is 2,3-dichloro-3-[(1,2-dichloro-2-cyano-1,2-difluoroethyl)disulfanyl]-2,3-difluoropropanenitrile.
| Compound Name | 2,3-dichloro-3-[(1,2-dichloro-2-cyano-1,2-difluoroethyl)disulfanyl]-2,3-difluoropropanenitrile |
|---|---|
| PubChem CID | 594030 |
| Molecular Formula | C6Cl4F4N2S2 |
| Molecular Weight | 382.02 g/mol |
| Exact Mass | 379.82 |
| IUPAC Name | 2,3-dichloro-3-[(1,2-dichloro-2-cyano-1,2-difluoroethyl)disulfanyl]-2,3-difluoropropanenitrile |
| SMILES | N#CC(F)(Cl)C(F)(Cl)SSC(F)(Cl)C(F)(Cl)C#N |
| InChI | InChI=1S/C6Cl4F4N2S2/c7-3(11,1-15)5(9,13)17-18-6(10,14)4(8,12)2-16 |
| InChIKey | PSAJALLFHNIJIX-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.02 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|