About 5-[2,4-bis(trifluoromethyl)phenyl]-N-cyclopentyl-2-methylpyrimidin-4-amine
5-[2,4-bis(trifluoromethyl)phenyl]-N-cyclopentyl-2-methylpyrimidin-4-amine (PubChem CID 59405039) has the molecular formula C18H17F6N3
and a molecular weight of 389.34 g/mol. Its IUPAC name is 5-[2,4-bis(trifluoromethyl)phenyl]-N-cyclopentyl-2-methylpyrimidin-4-amine.
Molecular Properties
| Compound Name | 5-[2,4-bis(trifluoromethyl)phenyl]-N-cyclopentyl-2-methylpyrimidin-4-amine |
| PubChem CID | 59405039 |
| Molecular Formula | C18H17F6N3 |
| Molecular Weight | 389.34 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | 5-[2,4-bis(trifluoromethyl)phenyl]-N-cyclopentyl-2-methylpyrimidin-4-amine |
| SMILES | Cc1ncc(-c2ccc(C(F)(F)F)cc2C(F)(F)F)c(NC2CCCC2)n1 |
| InChI | InChI=1S/C18H17F6N3/c1-10-25-9-14(16(26-10)27-12-4-2-3-5-12)13-7-6-11(17(19,20)21)8-15(13)18(22,23)24/h6-9,12H,2-5H2,1H3,(H,25,26,27) |
| InChIKey | CETXBVDUILNKAU-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 389.34 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-[2,4-bis(trifluoromethyl)phenyl]-N-cyclopentyl-2-methylpyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2,4-bis(trifluoromethyl)phenyl]-N-cyclopentyl-2-methylpyrimidin-4-amine?
The IUPAC name of 5-[2,4-bis(trifluoromethyl)phenyl]-N-cyclopentyl-2-methylpyrimidin-4-amine (CID 59405039) is 5-[2,4-bis(trifluoromethyl)phenyl]-N-cyclopentyl-2-methylpyrimidin-4-amine.
What is the SMILES notation for 5-[2,4-bis(trifluoromethyl)phenyl]-N-cyclopentyl-2-methylpyrimidin-4-amine?
The canonical SMILES for 5-[2,4-bis(trifluoromethyl)phenyl]-N-cyclopentyl-2-methylpyrimidin-4-amine is Cc1ncc(-c2ccc(C(F)(F)F)cc2C(F)(F)F)c(NC2CCCC2)n1.
What is the InChIKey of 5-[2,4-bis(trifluoromethyl)phenyl]-N-cyclopentyl-2-methylpyrimidin-4-amine?
The InChIKey is CETXBVDUILNKAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17F6N3/c1-10-25-9-14(16(26-10)27-12-4-2-3-5-12)13-7-6-11(17(19,20)21)8-15(13)18(22,23)24/h6-9,12H,2-5H2,1H3,(H,25,26,27).
What are the key properties of 5-[2,4-bis(trifluoromethyl)phenyl]-N-cyclopentyl-2-methylpyrimidin-4-amine?
5-[2,4-bis(trifluoromethyl)phenyl]-N-cyclopentyl-2-methylpyrimidin-4-amine has a molecular weight of 389.34 g/mol, XLogP of 5.84, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2,4-bis(trifluoromethyl)phenyl]-N-cyclopentyl-2-methylpyrimidin-4-amine is sourced from PubChem (CID 59405039), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).