C19H19Cl2N5O3S — CID 59406582
N-chloro-N-[2-chloro-5-(4-morpholin-4-ylquinazolin-6-yl)-3-pyridinyl]ethanesulfonamide (PubChem CID 59406582) has the molecular formula C19H19Cl2N5O3S and a molecular weight of 468.37 g/mol. Its IUPAC name is N-chloro-N-[2-chloro-5-(4-morpholin-4-ylquinazolin-6-yl)-3-pyridinyl]ethanesulfonamide.
| Compound Name | N-chloro-N-[2-chloro-5-(4-morpholin-4-ylquinazolin-6-yl)-3-pyridinyl]ethanesulfonamide |
|---|---|
| PubChem CID | 59406582 |
| Molecular Formula | C19H19Cl2N5O3S |
| Molecular Weight | 468.37 g/mol |
| Exact Mass | 467.06 |
| IUPAC Name | N-chloro-N-[2-chloro-5-(4-morpholin-4-ylquinazolin-6-yl)-3-pyridinyl]ethanesulfonamide |
| SMILES | CCS(=O)(=O)N(Cl)c1cc(-c2ccc3ncnc(N4CCOCC4)c3c2)cnc1Cl |
| InChI | InChI=1S/C19H19Cl2N5O3S/c1-2-30(27,28)26(21)17-10-14(11-22-18(17)20)13-3-4-16-15(9-13)19(24-12-23-16)25-5-7-29-8-6-25/h3-4,9-12H,2,5-8H2,1H3 |
| InChIKey | GIDODYSUFPMODK-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 88.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.37 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|