C24H29N5O3S — CID 68723909
N-cyclohexyl-N-[5-(4-morpholin-4-ylquinazolin-6-yl)-3-pyridinyl]methanesulfonamide (PubChem CID 68723909) has the molecular formula C24H29N5O3S and a molecular weight of 467.60 g/mol. Its IUPAC name is N-cyclohexyl-N-[5-(4-morpholin-4-ylquinazolin-6-yl)-3-pyridinyl]methanesulfonamide.
| Compound Name | N-cyclohexyl-N-[5-(4-morpholin-4-ylquinazolin-6-yl)-3-pyridinyl]methanesulfonamide |
|---|---|
| PubChem CID | 68723909 |
| Molecular Formula | C24H29N5O3S |
| Molecular Weight | 467.60 g/mol |
| Exact Mass | 467.20 |
| IUPAC Name | N-cyclohexyl-N-[5-(4-morpholin-4-ylquinazolin-6-yl)-3-pyridinyl]methanesulfonamide |
| SMILES | CS(=O)(=O)N(c1cncc(-c2ccc3ncnc(N4CCOCC4)c3c2)c1)C1CCCCC1 |
| InChI | InChI=1S/C24H29N5O3S/c1-33(30,31)29(20-5-3-2-4-6-20)21-13-19(15-25-16-21)18-7-8-23-22(14-18)24(27-17-26-23)28-9-11-32-12-10-28/h7-8,13-17,20H,2-6,9-12H2,1H3 |
| InChIKey | IAHIATOJUNTWNH-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 88.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.60 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |