C20H26F3NO3S — CID 59407609
2-amino-2-[2-[4-[3-(5-methylthiophen-2-yl)propoxy]-3-(trifluoromethyl)phenyl]ethyl]propane-1,3-diol (PubChem CID 59407609) has the molecular formula C20H26F3NO3S and a molecular weight of 417.49 g/mol. Its IUPAC name is 2-amino-2-[2-[4-[3-(5-methylthiophen-2-yl)propoxy]-3-(trifluoromethyl)phenyl]ethyl]propane-1,3-diol.
| Compound Name | 2-amino-2-[2-[4-[3-(5-methylthiophen-2-yl)propoxy]-3-(trifluoromethyl)phenyl]ethyl]propane-1,3-diol |
|---|---|
| PubChem CID | 59407609 |
| Molecular Formula | C20H26F3NO3S |
| Molecular Weight | 417.49 g/mol |
| Exact Mass | 417.16 |
| IUPAC Name | 2-amino-2-[2-[4-[3-(5-methylthiophen-2-yl)propoxy]-3-(trifluoromethyl)phenyl]ethyl]propane-1,3-diol |
| SMILES | Cc1ccc(CCCOc2ccc(CCC(N)(CO)CO)cc2C(F)(F)F)s1 |
| InChI | InChI=1S/C20H26F3NO3S/c1-14-4-6-16(28-14)3-2-10-27-18-7-5-15(11-17(18)20(21,22)23)8-9-19(24,12-25)13-26/h4-7,11,25-26H,2-3,8-10,12-13,24H2,1H3 |
| InChIKey | WRFLYMJABGSHMJ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.49 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|