C16H24FNO — CID 59409528
(E)-N-[4-(4-fluorophenyl)butoxy]-3,3-dimethylbutan-2-imine (PubChem CID 59409528) has the molecular formula C16H24FNO and a molecular weight of 265.37 g/mol. Its IUPAC name is (E)-N-[4-(4-fluorophenyl)butoxy]-3,3-dimethylbutan-2-imine.
| Compound Name | (E)-N-[4-(4-fluorophenyl)butoxy]-3,3-dimethylbutan-2-imine |
|---|---|
| PubChem CID | 59409528 |
| Molecular Formula | C16H24FNO |
| Molecular Weight | 265.37 g/mol |
| Exact Mass | 265.18 |
| IUPAC Name | (E)-N-[4-(4-fluorophenyl)butoxy]-3,3-dimethylbutan-2-imine |
| SMILES | C/C(=N\OCCCCc1ccc(F)cc1)C(C)(C)C |
| InChI | InChI=1S/C16H24FNO/c1-13(16(2,3)4)18-19-12-6-5-7-14-8-10-15(17)11-9-14/h8-11H,5-7,12H2,1-4H3/b18-13+ |
| InChIKey | QSDBBEMXOCRAQJ-QGOAFFKASA-N |
| XLogP | 4.59 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.37 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|