C18H27NO3 — CID 164679859
[(3E)-2,2-dimethyl-3-(3-phenylpropoxyimino)butyl] propanoate (PubChem CID 164679859) has the molecular formula C18H27NO3 and a molecular weight of 305.42 g/mol. Its IUPAC name is [(3E)-2,2-dimethyl-3-(3-phenylpropoxyimino)butyl] propanoate.
| Compound Name | [(3E)-2,2-dimethyl-3-(3-phenylpropoxyimino)butyl] propanoate |
|---|---|
| PubChem CID | 164679859 |
| Molecular Formula | C18H27NO3 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.20 |
| IUPAC Name | [(3E)-2,2-dimethyl-3-(3-phenylpropoxyimino)butyl] propanoate |
| SMILES | CCC(=O)OCC(C)(C)/C(C)=N/OCCCc1ccccc1 |
| InChI | InChI=1S/C18H27NO3/c1-5-17(20)21-14-18(3,4)15(2)19-22-13-9-12-16-10-7-6-8-11-16/h6-8,10-11H,5,9,12-14H2,1-4H3/b19-15+ |
| InChIKey | FCXZFEFCNAJMRT-XDJHFCHBSA-N |
| XLogP | 3.99 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|