C33H43N5O5S — CID 59412105
6-[[(2S)-2-acetamido-3,3-diphenylpropanoyl]amino]-2-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]hexanamide (PubChem CID 59412105) has the molecular formula C33H43N5O5S and a molecular weight of 621.80 g/mol. Its IUPAC name is 6-[[(2S)-2-acetamido-3,3-diphenylpropanoyl]amino]-2-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]hexanamide.
| Compound Name | 6-[[(2S)-2-acetamido-3,3-diphenylpropanoyl]amino]-2-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]hexanamide |
|---|---|
| PubChem CID | 59412105 |
| Molecular Formula | C33H43N5O5S |
| Molecular Weight | 621.80 g/mol |
| Exact Mass | 621.30 |
| IUPAC Name | 6-[[(2S)-2-acetamido-3,3-diphenylpropanoyl]amino]-2-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]hexanamide |
| SMILES | CC(=O)N[C@H](C(=O)NCCCCC(C(N)=O)N(CC(C)C)S(=O)(=O)c1ccc(N)cc1)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C33H43N5O5S/c1-23(2)22-38(44(42,43)28-19-17-27(34)18-20-28)29(32(35)40)16-10-11-21-36-33(41)31(37-24(3)39)30(25-12-6-4-7-13-25)26-14-8-5-9-15-26/h4-9,12-15,17-20,23,29-31H,10-11,16,21-22,34H2,1-3H3,(H2,35,40)(H,36,41)(H,37,39)/t29?,31-/m0/s1 |
| InChIKey | WDGCLYKYPJTZLA-RDFOUATCSA-N |
| XLogP | 3.39 |
| TPSA | 164.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.80 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|