C19H20F3N3O5 — CID 59416201
2-(3-ethoxypropoxy)-3-[4-(2,2,2-trifluoroethoxy)phenyl]-5,7-dihydropyrrolo[2,3-d]pyrimidine-4,6-dione (PubChem CID 59416201) has the molecular formula C19H20F3N3O5 and a molecular weight of 427.38 g/mol. Its IUPAC name is 2-(3-ethoxypropoxy)-3-[4-(2,2,2-trifluoroethoxy)phenyl]-5,7-dihydropyrrolo[2,3-d]pyrimidine-4,6-dione.
| Compound Name | 2-(3-ethoxypropoxy)-3-[4-(2,2,2-trifluoroethoxy)phenyl]-5,7-dihydropyrrolo[2,3-d]pyrimidine-4,6-dione |
|---|---|
| PubChem CID | 59416201 |
| Molecular Formula | C19H20F3N3O5 |
| Molecular Weight | 427.38 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | 2-(3-ethoxypropoxy)-3-[4-(2,2,2-trifluoroethoxy)phenyl]-5,7-dihydropyrrolo[2,3-d]pyrimidine-4,6-dione |
| SMILES | CCOCCCOc1nc2c(c(=O)n1-c1ccc(OCC(F)(F)F)cc1)CC(=O)N2 |
| InChI | InChI=1S/C19H20F3N3O5/c1-2-28-8-3-9-29-18-24-16-14(10-15(26)23-16)17(27)25(18)12-4-6-13(7-5-12)30-11-19(20,21)22/h4-7H,2-3,8-11H2,1H3,(H,23,26) |
| InChIKey | OTLBJPSYPLBWLI-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 91.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.38 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|