C28H31N5O — CID 59416652
3-[4-[3-methyl-2-[4-(pyridin-2-ylmethoxy)phenyl]butan-2-yl]phenyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine (PubChem CID 59416652) has the molecular formula C28H31N5O and a molecular weight of 453.59 g/mol. Its IUPAC name is 3-[4-[3-methyl-2-[4-(pyridin-2-ylmethoxy)phenyl]butan-2-yl]phenyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine.
| Compound Name | 3-[4-[3-methyl-2-[4-(pyridin-2-ylmethoxy)phenyl]butan-2-yl]phenyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine |
|---|---|
| PubChem CID | 59416652 |
| Molecular Formula | C28H31N5O |
| Molecular Weight | 453.59 g/mol |
| Exact Mass | 453.25 |
| IUPAC Name | 3-[4-[3-methyl-2-[4-(pyridin-2-ylmethoxy)phenyl]butan-2-yl]phenyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine |
| SMILES | CC(C)C(C)(c1ccc(OCc2ccccn2)cc1)c1ccc(-c2nnc3n2CCNC3)cc1 |
| InChI | InChI=1S/C28H31N5O/c1-20(2)28(3,23-11-13-25(14-12-23)34-19-24-6-4-5-15-30-24)22-9-7-21(8-10-22)27-32-31-26-18-29-16-17-33(26)27/h4-15,20,29H,16-19H2,1-3H3 |
| InChIKey | DSUNYRKSGZKRNO-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.59 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |