C27H26ClN3O — CID 59416741
3-chloro-6-[4-[3-methyl-2-[4-(pyridin-2-ylmethoxy)phenyl]butan-2-yl]phenyl]pyridazine (PubChem CID 59416741) has the molecular formula C27H26ClN3O and a molecular weight of 443.98 g/mol. Its IUPAC name is 3-chloro-6-[4-[3-methyl-2-[4-(pyridin-2-ylmethoxy)phenyl]butan-2-yl]phenyl]pyridazine.
| Compound Name | 3-chloro-6-[4-[3-methyl-2-[4-(pyridin-2-ylmethoxy)phenyl]butan-2-yl]phenyl]pyridazine |
|---|---|
| PubChem CID | 59416741 |
| Molecular Formula | C27H26ClN3O |
| Molecular Weight | 443.98 g/mol |
| Exact Mass | 443.18 |
| IUPAC Name | 3-chloro-6-[4-[3-methyl-2-[4-(pyridin-2-ylmethoxy)phenyl]butan-2-yl]phenyl]pyridazine |
| SMILES | CC(C)C(C)(c1ccc(OCc2ccccn2)cc1)c1ccc(-c2ccc(Cl)nn2)cc1 |
| InChI | InChI=1S/C27H26ClN3O/c1-19(2)27(3,21-9-7-20(8-10-21)25-15-16-26(28)31-30-25)22-11-13-24(14-12-22)32-18-23-6-4-5-17-29-23/h4-17,19H,18H2,1-3H3 |
| InChIKey | LHEJVTHPBIFNTA-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.98 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |