C27H25N3O2 — CID 66864843
3-methoxy-6-[4-[1-[4-(pyridin-2-ylmethoxy)phenyl]cyclobutyl]phenyl]pyridazine (PubChem CID 66864843) has the molecular formula C27H25N3O2 and a molecular weight of 423.52 g/mol. Its IUPAC name is 3-methoxy-6-[4-[1-[4-(pyridin-2-ylmethoxy)phenyl]cyclobutyl]phenyl]pyridazine.
| Compound Name | 3-methoxy-6-[4-[1-[4-(pyridin-2-ylmethoxy)phenyl]cyclobutyl]phenyl]pyridazine |
|---|---|
| PubChem CID | 66864843 |
| Molecular Formula | C27H25N3O2 |
| Molecular Weight | 423.52 g/mol |
| Exact Mass | 423.19 |
| IUPAC Name | 3-methoxy-6-[4-[1-[4-(pyridin-2-ylmethoxy)phenyl]cyclobutyl]phenyl]pyridazine |
| SMILES | COc1ccc(-c2ccc(C3(c4ccc(OCc5ccccn5)cc4)CCC3)cc2)nn1 |
| InChI | InChI=1S/C27H25N3O2/c1-31-26-15-14-25(29-30-26)20-6-8-21(9-7-20)27(16-4-17-27)22-10-12-24(13-11-22)32-19-23-5-2-3-18-28-23/h2-3,5-15,18H,4,16-17,19H2,1H3 |
| InChIKey | FNDGDHQZLHWGIQ-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 57.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.52 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |