C23H19F2NO2 — CID 88984289
4-[3,3-difluoro-1-[4-(pyridin-2-ylmethoxy)phenyl]cyclobutyl]benzaldehyde (PubChem CID 88984289) has the molecular formula C23H19F2NO2 and a molecular weight of 379.41 g/mol. Its IUPAC name is 4-[3,3-difluoro-1-[4-(pyridin-2-ylmethoxy)phenyl]cyclobutyl]benzaldehyde.
| Compound Name | 4-[3,3-difluoro-1-[4-(pyridin-2-ylmethoxy)phenyl]cyclobutyl]benzaldehyde |
|---|---|
| PubChem CID | 88984289 |
| Molecular Formula | C23H19F2NO2 |
| Molecular Weight | 379.41 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | 4-[3,3-difluoro-1-[4-(pyridin-2-ylmethoxy)phenyl]cyclobutyl]benzaldehyde |
| SMILES | O=Cc1ccc(C2(c3ccc(OCc4ccccn4)cc3)CC(F)(F)C2)cc1 |
| InChI | InChI=1S/C23H19F2NO2/c24-23(25)15-22(16-23,18-6-4-17(13-27)5-7-18)19-8-10-21(11-9-19)28-14-20-3-1-2-12-26-20/h1-13H,14-16H2 |
| InChIKey | QYRCUAAIAWTRHM-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.41 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|